C37H62O6Si2 — CID 68727651
[3-[2-[tert-butyl(dimethyl)silyl]oxyacetyl]oxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-[tert-butyl(dimethyl)silyl]oxyacetate (PubChem CID 68727651) has the molecular formula C37H62O6Si2 and a molecular weight of 659.07 g/mol. Its IUPAC name is [3-[2-[tert-butyl(dimethyl)silyl]oxyacetyl]oxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-[tert-butyl(dimethyl)silyl]oxyacetate.
| Compound Name | [3-[2-[tert-butyl(dimethyl)silyl]oxyacetyl]oxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-[tert-butyl(dimethyl)silyl]oxyacetate |
|---|---|
| PubChem CID | 68727651 |
| Molecular Formula | C37H62O6Si2 |
| Molecular Weight | 659.07 g/mol |
| Exact Mass | 658.41 |
| IUPAC Name | [3-[2-[tert-butyl(dimethyl)silyl]oxyacetyl]oxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-[tert-butyl(dimethyl)silyl]oxyacetate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(OC(=O)CO[Si](C)(C)C(C)(C)C)cc(CCCCC)cc1OC(=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H62O6Si2/c1-15-16-17-18-28-22-31(42-33(38)24-40-44(11,12)36(5,6)7)35(30-21-27(4)19-20-29(30)26(2)3)32(23-28)43-34(39)25-41-45(13,14)37(8,9)10/h21-23,29-30H,2,15-20,24-25H2,1,3-14H3/t29-,30+/m0/s1 |
| InChIKey | QTMBWYQUGBJXKA-XZWHSSHBSA-N |
| XLogP | 10.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.07 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|