C30H48O10P2 — CID 155575858
ethyl 3-[[3-[(3-ethoxy-3-oxopropyl)-methoxyphosphoryl]oxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]-methoxyphosphoryl]propanoate (PubChem CID 155575858) has the molecular formula C30H48O10P2 and a molecular weight of 630.65 g/mol. Its IUPAC name is ethyl 3-[[3-[(3-ethoxy-3-oxopropyl)-methoxyphosphoryl]oxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]-methoxyphosphoryl]propanoate.
| Compound Name | ethyl 3-[[3-[(3-ethoxy-3-oxopropyl)-methoxyphosphoryl]oxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]-methoxyphosphoryl]propanoate |
|---|---|
| PubChem CID | 155575858 |
| Molecular Formula | C30H48O10P2 |
| Molecular Weight | 630.65 g/mol |
| Exact Mass | 630.27 |
| IUPAC Name | ethyl 3-[[3-[(3-ethoxy-3-oxopropyl)-methoxyphosphoryl]oxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]-methoxyphosphoryl]propanoate |
| SMILES | CCCCCc1cc(OP(=O)(CCC(=O)OCC)OC)c(C2C=C(C)CCC2)c(OP(=O)(CCC(=O)OCC)OC)c1 |
| InChI | InChI=1S/C30H48O10P2/c1-7-10-11-14-24-21-26(39-41(33,35-5)18-16-28(31)37-8-2)30(25-15-12-13-23(4)20-25)27(22-24)40-42(34,36-6)19-17-29(32)38-9-3/h20-22,25H,7-19H2,1-6H3 |
| InChIKey | HCJKZNHDNLCWHH-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.65 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|