C32H54N2O8P2 — CID 155575668
propan-2-yl (2S)-2-[[methyl-[2-(3-methylcyclohex-2-en-1-yl)-3-[methyl-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]oxy-5-pentylphenoxy]phosphoryl]amino]propanoate (PubChem CID 155575668) has the molecular formula C32H54N2O8P2 and a molecular weight of 656.74 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[methyl-[2-(3-methylcyclohex-2-en-1-yl)-3-[methyl-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]oxy-5-pentylphenoxy]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[methyl-[2-(3-methylcyclohex-2-en-1-yl)-3-[methyl-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]oxy-5-pentylphenoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 155575668 |
| Molecular Formula | C32H54N2O8P2 |
| Molecular Weight | 656.74 g/mol |
| Exact Mass | 656.34 |
| IUPAC Name | propan-2-yl (2S)-2-[[methyl-[2-(3-methylcyclohex-2-en-1-yl)-3-[methyl-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]oxy-5-pentylphenoxy]phosphoryl]amino]propanoate |
| SMILES | CCCCCc1cc(OP(C)(=O)N[C@@H](C)C(=O)OC(C)C)c(C2C=C(C)CCC2)c(OP(C)(=O)N[C@@H](C)C(=O)OC(C)C)c1 |
| InChI | InChI=1S/C32H54N2O8P2/c1-11-12-13-16-26-19-28(41-43(9,37)33-24(7)31(35)39-21(2)3)30(27-17-14-15-23(6)18-27)29(20-26)42-44(10,38)34-25(8)32(36)40-22(4)5/h18-22,24-25,27H,11-17H2,1-10H3,(H,33,37)(H,34,38)/t24-,25-,27?,43?,44?/m0/s1 |
| InChIKey | BJPMOKCJPYDCTH-DUWIDNLVSA-N |
| XLogP | 7.90 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.74 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|