C24H37O6P — CID 155575775
3-[[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]-methoxyphosphoryl]propyl acetate (PubChem CID 155575775) has the molecular formula C24H37O6P and a molecular weight of 452.53 g/mol. Its IUPAC name is 3-[[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]-methoxyphosphoryl]propyl acetate.
| Compound Name | 3-[[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]-methoxyphosphoryl]propyl acetate |
|---|---|
| PubChem CID | 155575775 |
| Molecular Formula | C24H37O6P |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 3-[[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]-methoxyphosphoryl]propyl acetate |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CCC2)c(OP(=O)(CCCOC(C)=O)OC)c1 |
| InChI | InChI=1S/C24H37O6P/c1-5-6-7-11-20-16-22(26)24(21-12-8-10-18(2)15-21)23(17-20)30-31(27,28-4)14-9-13-29-19(3)25/h15-17,21,26H,5-14H2,1-4H3 |
| InChIKey | WROIOZKSTKFPGX-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|