C21H36NO6P — CID 167538191
azane;2-[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]propan-2-yl dihydrogen phosphate (PubChem CID 167538191) has the molecular formula C21H36NO6P and a molecular weight of 429.49 g/mol. Its IUPAC name is azane;2-[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]propan-2-yl dihydrogen phosphate.
| Compound Name | azane;2-[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]propan-2-yl dihydrogen phosphate |
|---|---|
| PubChem CID | 167538191 |
| Molecular Formula | C21H36NO6P |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | azane;2-[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]propan-2-yl dihydrogen phosphate |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CCC2)c(OC(C)(C)OP(=O)(O)O)c1.N |
| InChI | InChI=1S/C21H33O6P.H3N/c1-5-6-7-10-16-13-18(22)20(17-11-8-9-15(2)12-17)19(14-16)26-21(3,4)27-28(23,24)25;/h12-14,17,22H,5-11H2,1-4H3,(H2,23,24,25);1H3 |
| InChIKey | FALVUNMEIROYPZ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|