C24H36F2NO4P — CID 155575573
methyl (2S)-2-[[1,1-difluoroethyl-[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]phosphanyl]amino]propanoate (PubChem CID 155575573) has the molecular formula C24H36F2NO4P and a molecular weight of 471.53 g/mol. Its IUPAC name is methyl (2S)-2-[[1,1-difluoroethyl-[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]phosphanyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[1,1-difluoroethyl-[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]phosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 155575573 |
| Molecular Formula | C24H36F2NO4P |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | methyl (2S)-2-[[1,1-difluoroethyl-[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]phosphanyl]amino]propanoate |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CCC2)c(OP(N[C@@H](C)C(=O)OC)C(C)(F)F)c1 |
| InChI | InChI=1S/C24H36F2NO4P/c1-6-7-8-11-18-14-20(28)22(19-12-9-10-16(2)13-19)21(15-18)31-32(24(4,25)26)27-17(3)23(29)30-5/h13-15,17,19,27-28H,6-12H2,1-5H3/t17-,19?,32?/m0/s1 |
| InChIKey | AEHWFHVOFBYJTD-KUSSZLRCSA-N |
| XLogP | 6.79 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|