C29H48N2O7P2 — CID 167686886
ethyl 3-[methylamino-[3-[methylamino(3-oxobutyl)phosphoryl]oxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]phosphoryl]propanoate (PubChem CID 167686886) has the molecular formula C29H48N2O7P2 and a molecular weight of 598.66 g/mol. Its IUPAC name is ethyl 3-[methylamino-[3-[methylamino(3-oxobutyl)phosphoryl]oxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]phosphoryl]propanoate.
| Compound Name | ethyl 3-[methylamino-[3-[methylamino(3-oxobutyl)phosphoryl]oxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]phosphoryl]propanoate |
|---|---|
| PubChem CID | 167686886 |
| Molecular Formula | C29H48N2O7P2 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | ethyl 3-[methylamino-[3-[methylamino(3-oxobutyl)phosphoryl]oxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]phosphoryl]propanoate |
| SMILES | CCCCCc1cc(OP(=O)(CCC(C)=O)NC)c(C2C=C(C)CCC2)c(OP(=O)(CCC(=O)OCC)NC)c1 |
| InChI | InChI=1S/C29H48N2O7P2/c1-7-9-10-13-24-20-26(37-39(34,30-5)17-15-23(4)32)29(25-14-11-12-22(3)19-25)27(21-24)38-40(35,31-6)18-16-28(33)36-8-2/h19-21,25H,7-18H2,1-6H3,(H,30,34)(H,31,35) |
| InChIKey | WIOIWSILXHBALR-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|