C24H33O6P — CID 155575697
ethyl 3-[[3-hydroxy-2-(3-methylphenyl)-5-pentylphenoxy]-methoxyphosphoryl]propanoate (PubChem CID 155575697) has the molecular formula C24H33O6P and a molecular weight of 448.50 g/mol. Its IUPAC name is ethyl 3-[[3-hydroxy-2-(3-methylphenyl)-5-pentylphenoxy]-methoxyphosphoryl]propanoate.
| Compound Name | ethyl 3-[[3-hydroxy-2-(3-methylphenyl)-5-pentylphenoxy]-methoxyphosphoryl]propanoate |
|---|---|
| PubChem CID | 155575697 |
| Molecular Formula | C24H33O6P |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | ethyl 3-[[3-hydroxy-2-(3-methylphenyl)-5-pentylphenoxy]-methoxyphosphoryl]propanoate |
| SMILES | CCCCCc1cc(O)c(-c2cccc(C)c2)c(OP(=O)(CCC(=O)OCC)OC)c1 |
| InChI | InChI=1S/C24H33O6P/c1-5-7-8-11-19-16-21(25)24(20-12-9-10-18(3)15-20)22(17-19)30-31(27,28-4)14-13-23(26)29-6-2/h9-10,12,15-17,25H,5-8,11,13-14H2,1-4H3 |
| InChIKey | WCQJKWYAGCJFMC-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|