C24H36O10P2 — CID 155575881
2-[2-(3-methylphenyl)-5-pentyl-3-(2-phosphonooxypropan-2-yloxy)phenoxy]propan-2-yl dihydrogen phosphate (PubChem CID 155575881) has the molecular formula C24H36O10P2 and a molecular weight of 546.49 g/mol. Its IUPAC name is 2-[2-(3-methylphenyl)-5-pentyl-3-(2-phosphonooxypropan-2-yloxy)phenoxy]propan-2-yl dihydrogen phosphate.
| Compound Name | 2-[2-(3-methylphenyl)-5-pentyl-3-(2-phosphonooxypropan-2-yloxy)phenoxy]propan-2-yl dihydrogen phosphate |
|---|---|
| PubChem CID | 155575881 |
| Molecular Formula | C24H36O10P2 |
| Molecular Weight | 546.49 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | 2-[2-(3-methylphenyl)-5-pentyl-3-(2-phosphonooxypropan-2-yloxy)phenoxy]propan-2-yl dihydrogen phosphate |
| SMILES | CCCCCc1cc(OC(C)(C)OP(=O)(O)O)c(-c2cccc(C)c2)c(OC(C)(C)OP(=O)(O)O)c1 |
| InChI | InChI=1S/C24H36O10P2/c1-7-8-9-12-18-15-20(31-23(3,4)33-35(25,26)27)22(19-13-10-11-17(2)14-19)21(16-18)32-24(5,6)34-36(28,29)30/h10-11,13-16H,7-9,12H2,1-6H3,(H2,25,26,27)(H2,28,29,30) |
| InChIKey | AFVKJZJWDFAHHS-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|