C40H66O12 — CID 155461334
1,3-bis[1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-2-(3-methylphenyl)-5-pentylbenzene (PubChem CID 155461334) has the molecular formula C40H66O12 and a molecular weight of 738.96 g/mol. Its IUPAC name is 1,3-bis[1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-2-(3-methylphenyl)-5-pentylbenzene.
| Compound Name | 1,3-bis[1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-2-(3-methylphenyl)-5-pentylbenzene |
|---|---|
| PubChem CID | 155461334 |
| Molecular Formula | C40H66O12 |
| Molecular Weight | 738.96 g/mol |
| Exact Mass | 738.46 |
| IUPAC Name | 1,3-bis[1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-2-(3-methylphenyl)-5-pentylbenzene |
| SMILES | CCCCCc1cc(OC(C)OCCOCCOCCOCCOC)c(-c2cccc(C)c2)c(OC(C)OCCOCCOCCOCCOC)c1 |
| InChI | InChI=1S/C40H66O12/c1-7-8-9-12-36-31-38(51-34(3)49-28-26-47-24-22-45-20-18-43-16-14-41-5)40(37-13-10-11-33(2)30-37)39(32-36)52-35(4)50-29-27-48-25-23-46-21-19-44-17-15-42-6/h10-11,13,30-32,34-35H,7-9,12,14-29H2,1-6H3 |
| InChIKey | IWHJCWQQDFDAGM-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.96 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|