C14H24O3 — CID 69199580
1-methoxy-2-(2-methoxyethoxy)ethane;1,3-xylene (PubChem CID 69199580) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is 1-methoxy-2-(2-methoxyethoxy)ethane;1,3-xylene.
| Compound Name | 1-methoxy-2-(2-methoxyethoxy)ethane;1,3-xylene |
|---|---|
| PubChem CID | 69199580 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 1-methoxy-2-(2-methoxyethoxy)ethane;1,3-xylene |
| SMILES | COCCOCCOC.Cc1cccc(C)c1 |
| InChI | InChI=1S/C8H10.C6H14O3/c1-7-4-3-5-8(2)6-7;1-7-3-5-9-6-4-8-2/h3-6H,1-2H3;3-6H2,1-2H3 |
| InChIKey | YOQJJPXNQMCNPB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|