C16H24O4 — CID 126511463
2-[2-(oxiran-2-ylmethoxy)ethoxymethyl]oxirane;1,3-xylene (PubChem CID 126511463) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 2-[2-(oxiran-2-ylmethoxy)ethoxymethyl]oxirane;1,3-xylene.
| Compound Name | 2-[2-(oxiran-2-ylmethoxy)ethoxymethyl]oxirane;1,3-xylene |
|---|---|
| PubChem CID | 126511463 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-[2-(oxiran-2-ylmethoxy)ethoxymethyl]oxirane;1,3-xylene |
| SMILES | C(COCC1CO1)OCC1CO1.Cc1cccc(C)c1 |
| InChI | InChI=1S/C8H14O4.C8H10/c1(9-3-7-5-11-7)2-10-4-8-6-12-8;1-7-4-3-5-8(2)6-7/h7-8H,1-6H2;3-6H,1-2H3 |
| InChIKey | WSMGQUMHXNCWIC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|