C22H41NO6 — CID 118437277
2-(2-methoxyethoxy)-N,N-bis[2-(2-methoxyethoxy)ethyl]ethanamine;toluene (PubChem CID 118437277) has the molecular formula C22H41NO6 and a molecular weight of 415.57 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N,N-bis[2-(2-methoxyethoxy)ethyl]ethanamine;toluene.
| Compound Name | 2-(2-methoxyethoxy)-N,N-bis[2-(2-methoxyethoxy)ethyl]ethanamine;toluene |
|---|---|
| PubChem CID | 118437277 |
| Molecular Formula | C22H41NO6 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | 2-(2-methoxyethoxy)-N,N-bis[2-(2-methoxyethoxy)ethyl]ethanamine;toluene |
| SMILES | COCCOCCN(CCOCCOC)CCOCCOC.Cc1ccccc1 |
| InChI | InChI=1S/C15H33NO6.C7H8/c1-17-10-13-20-7-4-16(5-8-21-14-11-18-2)6-9-22-15-12-19-3;1-7-5-3-2-4-6-7/h4-15H2,1-3H3;2-6H,1H3 |
| InChIKey | VOHCEHHGJBUZMX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|