C20H35NO5 — CID 134464806
N-[2-[2-[2-(2,6-dimethylphenoxy)ethoxy]ethoxy]ethyl]-2-methoxy-N-(2-methoxyethyl)ethanamine (PubChem CID 134464806) has the molecular formula C20H35NO5 and a molecular weight of 369.50 g/mol. Its IUPAC name is N-[2-[2-[2-(2,6-dimethylphenoxy)ethoxy]ethoxy]ethyl]-2-methoxy-N-(2-methoxyethyl)ethanamine.
| Compound Name | N-[2-[2-[2-(2,6-dimethylphenoxy)ethoxy]ethoxy]ethyl]-2-methoxy-N-(2-methoxyethyl)ethanamine |
|---|---|
| PubChem CID | 134464806 |
| Molecular Formula | C20H35NO5 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | N-[2-[2-[2-(2,6-dimethylphenoxy)ethoxy]ethoxy]ethyl]-2-methoxy-N-(2-methoxyethyl)ethanamine |
| SMILES | COCCN(CCOC)CCOCCOCCOc1c(C)cccc1C |
| InChI | InChI=1S/C20H35NO5/c1-18-6-5-7-19(2)20(18)26-17-16-25-15-14-24-13-10-21(8-11-22-3)9-12-23-4/h5-7H,8-17H2,1-4H3 |
| InChIKey | CWFKGSLHPGKFRZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|