C15H37BNO6Rb — CID 139243294
boranuide;2-(2-methoxyethoxy)-N,N-bis[2-(2-methoxyethoxy)ethyl]ethanamine;rubidium(1+) (PubChem CID 139243294) has the molecular formula C15H37BNO6Rb and a molecular weight of 423.74 g/mol. Its IUPAC name is boranuide;2-(2-methoxyethoxy)-N,N-bis[2-(2-methoxyethoxy)ethyl]ethanamine;rubidium(1+).
| Compound Name | boranuide;2-(2-methoxyethoxy)-N,N-bis[2-(2-methoxyethoxy)ethyl]ethanamine;rubidium(1+) |
|---|---|
| PubChem CID | 139243294 |
| Molecular Formula | C15H37BNO6Rb |
| Molecular Weight | 423.74 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | boranuide;2-(2-methoxyethoxy)-N,N-bis[2-(2-methoxyethoxy)ethyl]ethanamine;rubidium(1+) |
| SMILES | COCCOCCN(CCOCCOC)CCOCCOC.[BH4-].[Rb+] |
| InChI | InChI=1S/C15H33NO6.BH4.Rb/c1-17-10-13-20-7-4-16(5-8-21-14-11-18-2)6-9-22-15-12-19-3;;/h4-15H2,1-3H3;1H4;/q;-1;+1 |
| InChIKey | XDVPXKLWAHAUEM-UHFFFAOYSA-N |
| XLogP | -4.17 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.74 |
| LogP ≤ 5 | -4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|