C13H28BrNO4 — CID 114263721
N-[2-(2-bromoethoxy)ethyl]-N-ethyl-2-[2-(2-methoxyethoxy)ethoxy]ethanamine (PubChem CID 114263721) has the molecular formula C13H28BrNO4 and a molecular weight of 342.27 g/mol. Its IUPAC name is N-[2-(2-bromoethoxy)ethyl]-N-ethyl-2-[2-(2-methoxyethoxy)ethoxy]ethanamine.
| Compound Name | N-[2-(2-bromoethoxy)ethyl]-N-ethyl-2-[2-(2-methoxyethoxy)ethoxy]ethanamine |
|---|---|
| PubChem CID | 114263721 |
| Molecular Formula | C13H28BrNO4 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[2-(2-bromoethoxy)ethyl]-N-ethyl-2-[2-(2-methoxyethoxy)ethoxy]ethanamine |
| SMILES | CCN(CCOCCBr)CCOCCOCCOC |
| InChI | InChI=1S/C13H28BrNO4/c1-3-15(5-8-17-7-4-14)6-9-18-12-13-19-11-10-16-2/h3-13H2,1-2H3 |
| InChIKey | KCYJMCRDPQJABS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|