C9H20ClNO2 — CID 63666499
N-[2-(2-chloroethoxy)ethyl]-N-ethyl-2-methoxyethanamine (PubChem CID 63666499) has the molecular formula C9H20ClNO2 and a molecular weight of 209.72 g/mol. Its IUPAC name is N-[2-(2-chloroethoxy)ethyl]-N-ethyl-2-methoxyethanamine.
| Compound Name | N-[2-(2-chloroethoxy)ethyl]-N-ethyl-2-methoxyethanamine |
|---|---|
| PubChem CID | 63666499 |
| Molecular Formula | C9H20ClNO2 |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-[2-(2-chloroethoxy)ethyl]-N-ethyl-2-methoxyethanamine |
| SMILES | CCN(CCOC)CCOCCCl |
| InChI | InChI=1S/C9H20ClNO2/c1-3-11(5-8-12-2)6-9-13-7-4-10/h3-9H2,1-2H3 |
| InChIKey | HNEWWVSNPVHKTE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|