C13H28ClNO3 — CID 113427470
N-(2-chloroethyl)-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]butan-1-amine (PubChem CID 113427470) has the molecular formula C13H28ClNO3 and a molecular weight of 281.82 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]butan-1-amine.
| Compound Name | N-(2-chloroethyl)-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]butan-1-amine |
|---|---|
| PubChem CID | 113427470 |
| Molecular Formula | C13H28ClNO3 |
| Molecular Weight | 281.82 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | N-(2-chloroethyl)-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]butan-1-amine |
| SMILES | CCCCN(CCCl)CCOCCOCCOC |
| InChI | InChI=1S/C13H28ClNO3/c1-3-4-6-15(7-5-14)8-9-17-12-13-18-11-10-16-2/h3-13H2,1-2H3 |
| InChIKey | DQBQTHMCLKRFIK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.82 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|