C14H28ClF2NO3 — CID 107487933
N-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-N-(2-chloroethyl)-2,2-difluoroethanamine (PubChem CID 107487933) has the molecular formula C14H28ClF2NO3 and a molecular weight of 331.83 g/mol. Its IUPAC name is N-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-N-(2-chloroethyl)-2,2-difluoroethanamine.
| Compound Name | N-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-N-(2-chloroethyl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 107487933 |
| Molecular Formula | C14H28ClF2NO3 |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | N-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-N-(2-chloroethyl)-2,2-difluoroethanamine |
| SMILES | CCCCOCCOCCOCCN(CCCl)CC(F)F |
| InChI | InChI=1S/C14H28ClF2NO3/c1-2-3-7-19-9-11-21-12-10-20-8-6-18(5-4-15)13-14(16)17/h14H,2-13H2,1H3 |
| InChIKey | USPMKPMGFMEJGJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|