C9H18ClF2NO2S — CID 107488098
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-3-ethylsulfonylpropan-1-amine (PubChem CID 107488098) has the molecular formula C9H18ClF2NO2S and a molecular weight of 277.76 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-3-ethylsulfonylpropan-1-amine.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-3-ethylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 107488098 |
| Molecular Formula | C9H18ClF2NO2S |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-3-ethylsulfonylpropan-1-amine |
| SMILES | CCS(=O)(=O)CCCN(CCCl)CC(F)F |
| InChI | InChI=1S/C9H18ClF2NO2S/c1-2-16(14,15)7-3-5-13(6-4-10)8-9(11)12/h9H,2-8H2,1H3 |
| InChIKey | JPMUXZAXSMNMHP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|