C8H14ClF2NO2S — CID 107492869
N-(2-chloroethyl)-1-cyclopropyl-N-(2,2-difluoroethyl)methanesulfonamide (PubChem CID 107492869) has the molecular formula C8H14ClF2NO2S and a molecular weight of 261.72 g/mol. Its IUPAC name is N-(2-chloroethyl)-1-cyclopropyl-N-(2,2-difluoroethyl)methanesulfonamide.
| Compound Name | N-(2-chloroethyl)-1-cyclopropyl-N-(2,2-difluoroethyl)methanesulfonamide |
|---|---|
| PubChem CID | 107492869 |
| Molecular Formula | C8H14ClF2NO2S |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | N-(2-chloroethyl)-1-cyclopropyl-N-(2,2-difluoroethyl)methanesulfonamide |
| SMILES | O=S(=O)(CC1CC1)N(CCCl)CC(F)F |
| InChI | InChI=1S/C8H14ClF2NO2S/c9-3-4-12(5-8(10)11)15(13,14)6-7-1-2-7/h7-8H,1-6H2 |
| InChIKey | HLBFJBHENSDSCN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|