C7H13ClF3N — CID 107488033
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-3-fluoropropan-1-amine (PubChem CID 107488033) has the molecular formula C7H13ClF3N and a molecular weight of 203.63 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-3-fluoropropan-1-amine.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-3-fluoropropan-1-amine |
|---|---|
| PubChem CID | 107488033 |
| Molecular Formula | C7H13ClF3N |
| Molecular Weight | 203.63 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-3-fluoropropan-1-amine |
| SMILES | FCCCN(CCCl)CC(F)F |
| InChI | InChI=1S/C7H13ClF3N/c8-2-5-12(4-1-3-9)6-7(10)11/h7H,1-6H2 |
| InChIKey | BDETWMHNLVSFGR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.63 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|