C9H12ClF2NS — CID 107487991
N-(2-chloroethyl)-2,2-difluoro-N-(thiophen-3-ylmethyl)ethanamine (PubChem CID 107487991) has the molecular formula C9H12ClF2NS and a molecular weight of 239.72 g/mol. Its IUPAC name is N-(2-chloroethyl)-2,2-difluoro-N-(thiophen-3-ylmethyl)ethanamine.
| Compound Name | N-(2-chloroethyl)-2,2-difluoro-N-(thiophen-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 107487991 |
| Molecular Formula | C9H12ClF2NS |
| Molecular Weight | 239.72 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | N-(2-chloroethyl)-2,2-difluoro-N-(thiophen-3-ylmethyl)ethanamine |
| SMILES | FC(F)CN(CCCl)Cc1ccsc1 |
| InChI | InChI=1S/C9H12ClF2NS/c10-2-3-13(6-9(11)12)5-8-1-4-14-7-8/h1,4,7,9H,2-3,5-6H2 |
| InChIKey | UQEICZHTIITBJV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.72 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|