C9H11BrClF2NS — CID 107487867
N-[(4-bromothiophen-2-yl)methyl]-N-(2-chloroethyl)-2,2-difluoroethanamine (PubChem CID 107487867) has the molecular formula C9H11BrClF2NS and a molecular weight of 318.61 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N-(2-chloroethyl)-2,2-difluoroethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N-(2-chloroethyl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 107487867 |
| Molecular Formula | C9H11BrClF2NS |
| Molecular Weight | 318.61 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N-(2-chloroethyl)-2,2-difluoroethanamine |
| SMILES | FC(F)CN(CCCl)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C9H11BrClF2NS/c10-7-3-8(15-6-7)4-14(2-1-11)5-9(12)13/h3,6,9H,1-2,4-5H2 |
| InChIKey | DZQAUSALBHASFA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.61 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|