C13H18ClF2N — CID 107487813
N-(2-chloroethyl)-N-[(2,6-dimethylphenyl)methyl]-2,2-difluoroethanamine (PubChem CID 107487813) has the molecular formula C13H18ClF2N and a molecular weight of 261.74 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-[(2,6-dimethylphenyl)methyl]-2,2-difluoroethanamine.
| Compound Name | N-(2-chloroethyl)-N-[(2,6-dimethylphenyl)methyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 107487813 |
| Molecular Formula | C13H18ClF2N |
| Molecular Weight | 261.74 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-(2-chloroethyl)-N-[(2,6-dimethylphenyl)methyl]-2,2-difluoroethanamine |
| SMILES | Cc1cccc(C)c1CN(CCCl)CC(F)F |
| InChI | InChI=1S/C13H18ClF2N/c1-10-4-3-5-11(2)12(10)8-17(7-6-14)9-13(15)16/h3-5,13H,6-9H2,1-2H3 |
| InChIKey | ZSKOOELLWRADSR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.74 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|