C10H14ClF2NS — CID 107487797
N-(2-chloroethyl)-2,2-difluoro-N-(2-thiophen-2-ylethyl)ethanamine (PubChem CID 107487797) has the molecular formula C10H14ClF2NS and a molecular weight of 253.74 g/mol. Its IUPAC name is N-(2-chloroethyl)-2,2-difluoro-N-(2-thiophen-2-ylethyl)ethanamine.
| Compound Name | N-(2-chloroethyl)-2,2-difluoro-N-(2-thiophen-2-ylethyl)ethanamine |
|---|---|
| PubChem CID | 107487797 |
| Molecular Formula | C10H14ClF2NS |
| Molecular Weight | 253.74 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | N-(2-chloroethyl)-2,2-difluoro-N-(2-thiophen-2-ylethyl)ethanamine |
| SMILES | FC(F)CN(CCCl)CCc1cccs1 |
| InChI | InChI=1S/C10H14ClF2NS/c11-4-6-14(8-10(12)13)5-3-9-2-1-7-15-9/h1-2,7,10H,3-6,8H2 |
| InChIKey | GMVJMJBSMSUQPY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.74 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|