C10H16ClNOS — CID 112561777
1-chloro-3-[methyl(2-thiophen-2-ylethyl)amino]propan-2-ol (PubChem CID 112561777) has the molecular formula C10H16ClNOS and a molecular weight of 233.76 g/mol. Its IUPAC name is 1-chloro-3-[methyl(2-thiophen-2-ylethyl)amino]propan-2-ol.
| Compound Name | 1-chloro-3-[methyl(2-thiophen-2-ylethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 112561777 |
| Molecular Formula | C10H16ClNOS |
| Molecular Weight | 233.76 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 1-chloro-3-[methyl(2-thiophen-2-ylethyl)amino]propan-2-ol |
| SMILES | CN(CCc1cccs1)CC(O)CCl |
| InChI | InChI=1S/C10H16ClNOS/c1-12(8-9(13)7-11)5-4-10-3-2-6-14-10/h2-3,6,9,13H,4-5,7-8H2,1H3 |
| InChIKey | IIKWUBXYIALKIP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.76 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|