C13H24N2OS — CID 79476363
1-[methyl(2-thiophen-2-ylethyl)amino]-3-(propan-2-ylamino)propan-2-ol (PubChem CID 79476363) has the molecular formula C13H24N2OS and a molecular weight of 256.41 g/mol. Its IUPAC name is 1-[methyl(2-thiophen-2-ylethyl)amino]-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | 1-[methyl(2-thiophen-2-ylethyl)amino]-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 79476363 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 1-[methyl(2-thiophen-2-ylethyl)amino]-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NCC(O)CN(C)CCc1cccs1 |
| InChI | InChI=1S/C13H24N2OS/c1-11(2)14-9-12(16)10-15(3)7-6-13-5-4-8-17-13/h4-5,8,11-12,14,16H,6-7,9-10H2,1-3H3 |
| InChIKey | RZSCMIILPXZMDX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |