C13H23NO2S — CID 79486334
2,2-diethoxy-N-methyl-N-(2-thiophen-2-ylethyl)ethanamine (PubChem CID 79486334) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is 2,2-diethoxy-N-methyl-N-(2-thiophen-2-ylethyl)ethanamine.
| Compound Name | 2,2-diethoxy-N-methyl-N-(2-thiophen-2-ylethyl)ethanamine |
|---|---|
| PubChem CID | 79486334 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2,2-diethoxy-N-methyl-N-(2-thiophen-2-ylethyl)ethanamine |
| SMILES | CCOC(CN(C)CCc1cccs1)OCC |
| InChI | InChI=1S/C13H23NO2S/c1-4-15-13(16-5-2)11-14(3)9-8-12-7-6-10-17-12/h6-7,10,13H,4-5,8-9,11H2,1-3H3 |
| InChIKey | YDGRGXIKXWJCTK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|