C11H18BrNOS — CID 80690433
2-bromo-3-methoxy-N-methyl-N-(2-thiophen-2-ylethyl)propan-1-amine (PubChem CID 80690433) has the molecular formula C11H18BrNOS and a molecular weight of 292.24 g/mol. Its IUPAC name is 2-bromo-3-methoxy-N-methyl-N-(2-thiophen-2-ylethyl)propan-1-amine.
| Compound Name | 2-bromo-3-methoxy-N-methyl-N-(2-thiophen-2-ylethyl)propan-1-amine |
|---|---|
| PubChem CID | 80690433 |
| Molecular Formula | C11H18BrNOS |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2-bromo-3-methoxy-N-methyl-N-(2-thiophen-2-ylethyl)propan-1-amine |
| SMILES | COCC(Br)CN(C)CCc1cccs1 |
| InChI | InChI=1S/C11H18BrNOS/c1-13(8-10(12)9-14-2)6-5-11-4-3-7-15-11/h3-4,7,10H,5-6,8-9H2,1-2H3 |
| InChIKey | YJOMICDXWFRZDF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|