C10H16BrNS — CID 80668223
2-bromo-N-methyl-N-(2-thiophen-2-ylethyl)propan-1-amine (PubChem CID 80668223) has the molecular formula C10H16BrNS and a molecular weight of 262.22 g/mol. Its IUPAC name is 2-bromo-N-methyl-N-(2-thiophen-2-ylethyl)propan-1-amine.
| Compound Name | 2-bromo-N-methyl-N-(2-thiophen-2-ylethyl)propan-1-amine |
|---|---|
| PubChem CID | 80668223 |
| Molecular Formula | C10H16BrNS |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 2-bromo-N-methyl-N-(2-thiophen-2-ylethyl)propan-1-amine |
| SMILES | CC(Br)CN(C)CCc1cccs1 |
| InChI | InChI=1S/C10H16BrNS/c1-9(11)8-12(2)6-5-10-4-3-7-13-10/h3-4,7,9H,5-6,8H2,1-2H3 |
| InChIKey | LEUDRXCTYMSBMC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|