C13H22ClNS — CID 79485974
5-chloro-N,3-dimethyl-N-(2-thiophen-2-ylethyl)pentan-1-amine (PubChem CID 79485974) has the molecular formula C13H22ClNS and a molecular weight of 259.85 g/mol. Its IUPAC name is 5-chloro-N,3-dimethyl-N-(2-thiophen-2-ylethyl)pentan-1-amine.
| Compound Name | 5-chloro-N,3-dimethyl-N-(2-thiophen-2-ylethyl)pentan-1-amine |
|---|---|
| PubChem CID | 79485974 |
| Molecular Formula | C13H22ClNS |
| Molecular Weight | 259.85 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 5-chloro-N,3-dimethyl-N-(2-thiophen-2-ylethyl)pentan-1-amine |
| SMILES | CC(CCCl)CCN(C)CCc1cccs1 |
| InChI | InChI=1S/C13H22ClNS/c1-12(5-8-14)6-9-15(2)10-7-13-4-3-11-16-13/h3-4,11-12H,5-10H2,1-2H3 |
| InChIKey | CRJVKGNWFLXFQD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.85 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|