C10H14N2S — CID 63774352
3-[methyl(2-thiophen-2-ylethyl)amino]propanenitrile (PubChem CID 63774352) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is 3-[methyl(2-thiophen-2-ylethyl)amino]propanenitrile.
| Compound Name | 3-[methyl(2-thiophen-2-ylethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 63774352 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3-[methyl(2-thiophen-2-ylethyl)amino]propanenitrile |
| SMILES | CN(CCC#N)CCc1cccs1 |
| InChI | InChI=1S/C10H14N2S/c1-12(7-3-6-11)8-5-10-4-2-9-13-10/h2,4,9H,3,5,7-8H2,1H3 |
| InChIKey | XWQDZTQEOWJQFA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |