C15H15FN2S — CID 103758567
2-fluoro-5-[[methyl(2-thiophen-2-ylethyl)amino]methyl]benzonitrile (PubChem CID 103758567) has the molecular formula C15H15FN2S and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-fluoro-5-[[methyl(2-thiophen-2-ylethyl)amino]methyl]benzonitrile.
| Compound Name | 2-fluoro-5-[[methyl(2-thiophen-2-ylethyl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 103758567 |
| Molecular Formula | C15H15FN2S |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-fluoro-5-[[methyl(2-thiophen-2-ylethyl)amino]methyl]benzonitrile |
| SMILES | CN(CCc1cccs1)Cc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C15H15FN2S/c1-18(7-6-14-3-2-8-19-14)11-12-4-5-15(16)13(9-12)10-17/h2-5,8-9H,6-7,11H2,1H3 |
| InChIKey | OTAJAILXNOXARZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |