About N,N-dimethyl-2-thiophen-2-ylethanamine;hydrochloride
N,N-dimethyl-2-thiophen-2-ylethanamine;hydrochloride (PubChem CID 19760547) has the molecular formula C8H14ClNS
and a molecular weight of 191.73 g/mol. Its IUPAC name is N,N-dimethyl-2-thiophen-2-ylethanamine;hydrochloride.
Analyze N,N-dimethyl-2-thiophen-2-ylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-thiophen-2-ylethanamine;hydrochloride?
The IUPAC name of N,N-dimethyl-2-thiophen-2-ylethanamine;hydrochloride (CID 19760547) is N,N-dimethyl-2-thiophen-2-ylethanamine;hydrochloride.
What is the SMILES notation for N,N-dimethyl-2-thiophen-2-ylethanamine;hydrochloride?
The canonical SMILES for N,N-dimethyl-2-thiophen-2-ylethanamine;hydrochloride is CN(C)CCc1cccs1.Cl.
What is the InChIKey of N,N-dimethyl-2-thiophen-2-ylethanamine;hydrochloride?
The InChIKey is WXLJRASEJDYXFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NS.ClH/c1-9(2)6-5-8-4-3-7-10-8;/h3-4,7H,5-6H2,1-2H3;1H.
What are the key properties of N,N-dimethyl-2-thiophen-2-ylethanamine;hydrochloride?
N,N-dimethyl-2-thiophen-2-ylethanamine;hydrochloride has a molecular weight of 191.73 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-thiophen-2-ylethanamine;hydrochloride is sourced from PubChem (CID 19760547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).