C9H15BrN2OS — CID 112644425
2-bromo-3-methoxy-N-methyl-N-(1,3-thiazol-5-ylmethyl)propan-1-amine (PubChem CID 112644425) has the molecular formula C9H15BrN2OS and a molecular weight of 279.20 g/mol. Its IUPAC name is 2-bromo-3-methoxy-N-methyl-N-(1,3-thiazol-5-ylmethyl)propan-1-amine.
| Compound Name | 2-bromo-3-methoxy-N-methyl-N-(1,3-thiazol-5-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 112644425 |
| Molecular Formula | C9H15BrN2OS |
| Molecular Weight | 279.20 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 2-bromo-3-methoxy-N-methyl-N-(1,3-thiazol-5-ylmethyl)propan-1-amine |
| SMILES | COCC(Br)CN(C)Cc1cncs1 |
| InChI | InChI=1S/C9H15BrN2OS/c1-12(4-8(10)6-13-2)5-9-3-11-7-14-9/h3,7-8H,4-6H2,1-2H3 |
| InChIKey | XLQBLGCQCKFXQG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|