C15H25NO2S — CID 55249177
N-(3,3-diethoxypropyl)-N-(thiophen-2-ylmethyl)cyclopropanamine (PubChem CID 55249177) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)-N-(thiophen-2-ylmethyl)cyclopropanamine.
| Compound Name | N-(3,3-diethoxypropyl)-N-(thiophen-2-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 55249177 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-(3,3-diethoxypropyl)-N-(thiophen-2-ylmethyl)cyclopropanamine |
| SMILES | CCOC(CCN(Cc1cccs1)C1CC1)OCC |
| InChI | InChI=1S/C15H25NO2S/c1-3-17-15(18-4-2)9-10-16(13-7-8-13)12-14-6-5-11-19-14/h5-6,11,13,15H,3-4,7-10,12H2,1-2H3 |
| InChIKey | YXBQKNDRPSISRB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|