C16H26N2OS — CID 52569061
2-[cyclopropyl(thiophen-2-ylmethyl)amino]-N,N-dipropylacetamide (PubChem CID 52569061) has the molecular formula C16H26N2OS and a molecular weight of 294.46 g/mol. Its IUPAC name is 2-[cyclopropyl(thiophen-2-ylmethyl)amino]-N,N-dipropylacetamide.
| Compound Name | 2-[cyclopropyl(thiophen-2-ylmethyl)amino]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 52569061 |
| Molecular Formula | C16H26N2OS |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 2-[cyclopropyl(thiophen-2-ylmethyl)amino]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)CN(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C16H26N2OS/c1-3-9-17(10-4-2)16(19)13-18(14-7-8-14)12-15-6-5-11-20-15/h5-6,11,14H,3-4,7-10,12-13H2,1-2H3 |
| InChIKey | DESSSLJUPUNRNA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |