C18H22N2OS — CID 134001322
2-[cyclopropyl(thiophen-2-ylmethyl)amino]-N-ethyl-N-phenylacetamide (PubChem CID 134001322) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is 2-[cyclopropyl(thiophen-2-ylmethyl)amino]-N-ethyl-N-phenylacetamide.
| Compound Name | 2-[cyclopropyl(thiophen-2-ylmethyl)amino]-N-ethyl-N-phenylacetamide |
|---|---|
| PubChem CID | 134001322 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-[cyclopropyl(thiophen-2-ylmethyl)amino]-N-ethyl-N-phenylacetamide |
| SMILES | CCN(C(=O)CN(Cc1cccs1)C1CC1)c1ccccc1 |
| InChI | InChI=1S/C18H22N2OS/c1-2-20(16-7-4-3-5-8-16)18(21)14-19(15-10-11-15)13-17-9-6-12-22-17/h3-9,12,15H,2,10-11,13-14H2,1H3 |
| InChIKey | PTVFGJIZYCGRLI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |