C12H15NS — CID 63655817
N-but-3-ynyl-N-(thiophen-2-ylmethyl)cyclopropanamine (PubChem CID 63655817) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is N-but-3-ynyl-N-(thiophen-2-ylmethyl)cyclopropanamine.
| Compound Name | N-but-3-ynyl-N-(thiophen-2-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 63655817 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N-but-3-ynyl-N-(thiophen-2-ylmethyl)cyclopropanamine |
| SMILES | C#CCCN(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C12H15NS/c1-2-3-8-13(11-6-7-11)10-12-5-4-9-14-12/h1,4-5,9,11H,3,6-8,10H2 |
| InChIKey | DQTBOSPOQWFEQU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|