C17H29NS2 — CID 105344206
9-[cyclopropyl(thiophen-2-ylmethyl)amino]nonane-1-thiol (PubChem CID 105344206) has the molecular formula C17H29NS2 and a molecular weight of 311.56 g/mol. Its IUPAC name is 9-[cyclopropyl(thiophen-2-ylmethyl)amino]nonane-1-thiol.
| Compound Name | 9-[cyclopropyl(thiophen-2-ylmethyl)amino]nonane-1-thiol |
|---|---|
| PubChem CID | 105344206 |
| Molecular Formula | C17H29NS2 |
| Molecular Weight | 311.56 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 9-[cyclopropyl(thiophen-2-ylmethyl)amino]nonane-1-thiol |
| SMILES | SCCCCCCCCCN(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C17H29NS2/c19-13-7-5-3-1-2-4-6-12-18(16-10-11-16)15-17-9-8-14-20-17/h8-9,14,16,19H,1-7,10-13,15H2 |
| InChIKey | ANDGCSKWBFPYQI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|