C14H26N2S — CID 79476641
2-N,3-dimethyl-2-N-(2-thiophen-2-ylethyl)hexane-1,2-diamine (PubChem CID 79476641) has the molecular formula C14H26N2S and a molecular weight of 254.44 g/mol. Its IUPAC name is 2-N,3-dimethyl-2-N-(2-thiophen-2-ylethyl)hexane-1,2-diamine.
| Compound Name | 2-N,3-dimethyl-2-N-(2-thiophen-2-ylethyl)hexane-1,2-diamine |
|---|---|
| PubChem CID | 79476641 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 2-N,3-dimethyl-2-N-(2-thiophen-2-ylethyl)hexane-1,2-diamine |
| SMILES | CCCC(C)C(CN)N(C)CCc1cccs1 |
| InChI | InChI=1S/C14H26N2S/c1-4-6-12(2)14(11-15)16(3)9-8-13-7-5-10-17-13/h5,7,10,12,14H,4,6,8-9,11,15H2,1-3H3 |
| InChIKey | WXQUVLVRYHYHJV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |