C13H24N2O2S — CID 79475548
4,4-dimethoxy-2-N-methyl-2-N-(2-thiophen-2-ylethyl)butane-1,2-diamine (PubChem CID 79475548) has the molecular formula C13H24N2O2S and a molecular weight of 272.41 g/mol. Its IUPAC name is 4,4-dimethoxy-2-N-methyl-2-N-(2-thiophen-2-ylethyl)butane-1,2-diamine.
| Compound Name | 4,4-dimethoxy-2-N-methyl-2-N-(2-thiophen-2-ylethyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 79475548 |
| Molecular Formula | C13H24N2O2S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 4,4-dimethoxy-2-N-methyl-2-N-(2-thiophen-2-ylethyl)butane-1,2-diamine |
| SMILES | COC(CC(CN)N(C)CCc1cccs1)OC |
| InChI | InChI=1S/C13H24N2O2S/c1-15(7-6-12-5-4-8-18-12)11(10-14)9-13(16-2)17-3/h4-5,8,11,13H,6-7,9-10,14H2,1-3H3 |
| InChIKey | OOUFVQXFVCDWED-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|