C11H19NS — CID 61078853
3-methyl-1-thiophen-2-ylhexan-2-amine (PubChem CID 61078853) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is 3-methyl-1-thiophen-2-ylhexan-2-amine.
| Compound Name | 3-methyl-1-thiophen-2-ylhexan-2-amine |
|---|---|
| PubChem CID | 61078853 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 3-methyl-1-thiophen-2-ylhexan-2-amine |
| SMILES | CCCC(C)C(N)Cc1cccs1 |
| InChI | InChI=1S/C11H19NS/c1-3-5-9(2)11(12)8-10-6-4-7-13-10/h4,6-7,9,11H,3,5,8,12H2,1-2H3 |
| InChIKey | PICLRDUWOYJEPM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |