C9H15NO2S — CID 79492317
1,1-dimethoxy-3-thiophen-2-ylpropan-2-amine (PubChem CID 79492317) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is 1,1-dimethoxy-3-thiophen-2-ylpropan-2-amine.
| Compound Name | 1,1-dimethoxy-3-thiophen-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 79492317 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 1,1-dimethoxy-3-thiophen-2-ylpropan-2-amine |
| SMILES | COC(OC)C(N)Cc1cccs1 |
| InChI | InChI=1S/C9H15NO2S/c1-11-9(12-2)8(10)6-7-4-3-5-13-7/h3-5,8-9H,6,10H2,1-2H3 |
| InChIKey | QVPZOKAWSRDTDR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|