About ethane;(2S)-1-methoxy-3-thiophen-2-ylpropan-2-amine;molecular hydrogen
ethane;(2S)-1-methoxy-3-thiophen-2-ylpropan-2-amine;molecular hydrogen (PubChem CID 177035877) has the molecular formula C12H27NOS
and a molecular weight of 233.42 g/mol. Its IUPAC name is ethane;(2S)-1-methoxy-3-thiophen-2-ylpropan-2-amine;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;(2S)-1-methoxy-3-thiophen-2-ylpropan-2-amine;molecular hydrogen |
| PubChem CID | 177035877 |
| Molecular Formula | C12H27NOS |
| Molecular Weight | 233.42 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | ethane;(2S)-1-methoxy-3-thiophen-2-ylpropan-2-amine;molecular hydrogen |
| SMILES | CC.CC.COC[C@@H](N)Cc1cccs1.[H][H] |
| InChI | InChI=1S/C8H13NOS.2C2H6.H2/c1-10-6-7(9)5-8-3-2-4-11-8;2*1-2;/h2-4,7H,5-6,9H2,1H3;2*1-2H3;1H/t7-;;;/m0.../s1 |
| InChIKey | VSWGBTWVOVEDAA-QTPLPEIMSA-N |
| XLogP | 3.56 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;(2S)-1-methoxy-3-thiophen-2-ylpropan-2-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2S)-1-methoxy-3-thiophen-2-ylpropan-2-amine;molecular hydrogen?
The IUPAC name of ethane;(2S)-1-methoxy-3-thiophen-2-ylpropan-2-amine;molecular hydrogen (CID 177035877) is ethane;(2S)-1-methoxy-3-thiophen-2-ylpropan-2-amine;molecular hydrogen.
What is the SMILES notation for ethane;(2S)-1-methoxy-3-thiophen-2-ylpropan-2-amine;molecular hydrogen?
The canonical SMILES for ethane;(2S)-1-methoxy-3-thiophen-2-ylpropan-2-amine;molecular hydrogen is CC.CC.COC[C@@H](N)Cc1cccs1.[H][H].
What is the InChIKey of ethane;(2S)-1-methoxy-3-thiophen-2-ylpropan-2-amine;molecular hydrogen?
The InChIKey is VSWGBTWVOVEDAA-QTPLPEIMSA-N. The full InChI is InChI=1S/C8H13NOS.2C2H6.H2/c1-10-6-7(9)5-8-3-2-4-11-8;2*1-2;/h2-4,7H,5-6,9H2,1H3;2*1-2H3;1H/t7-;;;/m0.../s1.
What are the key properties of ethane;(2S)-1-methoxy-3-thiophen-2-ylpropan-2-amine;molecular hydrogen?
ethane;(2S)-1-methoxy-3-thiophen-2-ylpropan-2-amine;molecular hydrogen has a molecular weight of 233.42 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2S)-1-methoxy-3-thiophen-2-ylpropan-2-amine;molecular hydrogen is sourced from PubChem (CID 177035877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).