C12H22N2OS — CID 63291858
1-(dimethylamino)-3-(1-thiophen-2-ylpropan-2-ylamino)propan-2-ol (PubChem CID 63291858) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is 1-(dimethylamino)-3-(1-thiophen-2-ylpropan-2-ylamino)propan-2-ol.
| Compound Name | 1-(dimethylamino)-3-(1-thiophen-2-ylpropan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 63291858 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-(dimethylamino)-3-(1-thiophen-2-ylpropan-2-ylamino)propan-2-ol |
| SMILES | CC(Cc1cccs1)NCC(O)CN(C)C |
| InChI | InChI=1S/C12H22N2OS/c1-10(7-12-5-4-6-16-12)13-8-11(15)9-14(2)3/h4-6,10-11,13,15H,7-9H2,1-3H3 |
| InChIKey | UWDBZORRRXSJSV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |