C10H12BrClF2N2 — CID 107487899
N-[(5-bromo-2-pyridinyl)methyl]-N-(2-chloroethyl)-2,2-difluoroethanamine (PubChem CID 107487899) has the molecular formula C10H12BrClF2N2 and a molecular weight of 313.57 g/mol. Its IUPAC name is N-[(5-bromo-2-pyridinyl)methyl]-N-(2-chloroethyl)-2,2-difluoroethanamine.
| Compound Name | N-[(5-bromo-2-pyridinyl)methyl]-N-(2-chloroethyl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 107487899 |
| Molecular Formula | C10H12BrClF2N2 |
| Molecular Weight | 313.57 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | N-[(5-bromo-2-pyridinyl)methyl]-N-(2-chloroethyl)-2,2-difluoroethanamine |
| SMILES | FC(F)CN(CCCl)Cc1ccc(Br)cn1 |
| InChI | InChI=1S/C10H12BrClF2N2/c11-8-1-2-9(15-5-8)6-16(4-3-12)7-10(13)14/h1-2,5,10H,3-4,6-7H2 |
| InChIKey | YKDSQPGSXAREON-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|