C12H18Br2N2 — CID 107204834
5-bromo-N-[(5-bromo-2-pyridinyl)methyl]-N-methylpentan-1-amine (PubChem CID 107204834) has the molecular formula C12H18Br2N2 and a molecular weight of 350.10 g/mol. Its IUPAC name is 5-bromo-N-[(5-bromo-2-pyridinyl)methyl]-N-methylpentan-1-amine.
| Compound Name | 5-bromo-N-[(5-bromo-2-pyridinyl)methyl]-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 107204834 |
| Molecular Formula | C12H18Br2N2 |
| Molecular Weight | 350.10 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 5-bromo-N-[(5-bromo-2-pyridinyl)methyl]-N-methylpentan-1-amine |
| SMILES | CN(CCCCCBr)Cc1ccc(Br)cn1 |
| InChI | InChI=1S/C12H18Br2N2/c1-16(8-4-2-3-7-13)10-12-6-5-11(14)9-15-12/h5-6,9H,2-4,7-8,10H2,1H3 |
| InChIKey | TVEDBORKJBVZEG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.10 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|