C10H15BrN2O2S — CID 115622483
N-[(5-bromo-2-pyridinyl)methyl]-N-methyl-2-methylsulfonylethanamine (PubChem CID 115622483) has the molecular formula C10H15BrN2O2S and a molecular weight of 307.21 g/mol. Its IUPAC name is N-[(5-bromo-2-pyridinyl)methyl]-N-methyl-2-methylsulfonylethanamine.
| Compound Name | N-[(5-bromo-2-pyridinyl)methyl]-N-methyl-2-methylsulfonylethanamine |
|---|---|
| PubChem CID | 115622483 |
| Molecular Formula | C10H15BrN2O2S |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | N-[(5-bromo-2-pyridinyl)methyl]-N-methyl-2-methylsulfonylethanamine |
| SMILES | CN(CCS(C)(=O)=O)Cc1ccc(Br)cn1 |
| InChI | InChI=1S/C10H15BrN2O2S/c1-13(5-6-16(2,14)15)8-10-4-3-9(11)7-12-10/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | QNCUCTXRJXVKSU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |